C17H34N4O3 — CID 19090275
6-hydrazinyl-N-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-6-oxohexanamide (PubChem CID 19090275) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 6-hydrazinyl-N-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-6-oxohexanamide.
| Compound Name | 6-hydrazinyl-N-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-6-oxohexanamide |
|---|---|
| PubChem CID | 19090275 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 6-hydrazinyl-N-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-6-oxohexanamide |
| SMILES | CC(O)N1C(C)(C)CC(NC(=O)CCCCC(=O)NN)CC1(C)C |
| InChI | InChI=1S/C17H34N4O3/c1-12(22)21-16(2,3)10-13(11-17(21,4)5)19-14(23)8-6-7-9-15(24)20-18/h12-13,22H,6-11,18H2,1-5H3,(H,19,23)(H,20,24) |
| InChIKey | RZULNIDKZXNJSX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|