C12H23ClN2O2 — CID 91987853
3-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 91987853) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 3-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 91987853 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-chloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | CC1(C)CC(NC(=O)CCCl)CC(C)(C)N1O |
| InChI | InChI=1S/C12H23ClN2O2/c1-11(2)7-9(14-10(16)5-6-13)8-12(3,4)15(11)17/h9,17H,5-8H2,1-4H3,(H,14,16) |
| InChIKey | GEMTWBBMWQZJKT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|