C16H32N2O4 — CID 59426558
6-hydroxyhexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate (PubChem CID 59426558) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is 6-hydroxyhexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate.
| Compound Name | 6-hydroxyhexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 59426558 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 6-hydroxyhexyl N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCCCCCO)CC(C)(C)N1O |
| InChI | InChI=1S/C16H32N2O4/c1-15(2)11-13(12-16(3,4)18(15)21)17-14(20)22-10-8-6-5-7-9-19/h13,19,21H,5-12H2,1-4H3,(H,17,20) |
| InChIKey | RIVRCCZDTOZBHG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|