C12H24N2O2 — CID 126614954
N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)butanamide (PubChem CID 126614954) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)butanamide.
| Compound Name | N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 126614954 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)butanamide |
| SMILES | CCCC(=O)NC1CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-6-7-10(15)13-9-8-11(2,3)14(16)12(9,4)5/h9,16H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | VKWMBYJJWNQXJT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |