C18H28N2O6S — CID 88970003
[2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)amino]-2-oxoethoxy]methyl 4-methylbenzenesulfonate (PubChem CID 88970003) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is [2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)amino]-2-oxoethoxy]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)amino]-2-oxoethoxy]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88970003 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-[(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)amino]-2-oxoethoxy]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCOCC(=O)NC2CC(C)(C)N(O)C2(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O6S/c1-13-6-8-14(9-7-13)27(23,24)26-12-25-11-16(21)19-15-10-17(2,3)20(22)18(15,4)5/h6-9,15,22H,10-12H2,1-5H3,(H,19,21) |
| InChIKey | YCTMJCCGXOGXCJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|