C16H25NO4S — CID 89268299
(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 4-methylbenzenesulfonate (PubChem CID 89268299) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89268299 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(C)(C)N(O)C2(C)C)cc1 |
| InChI | InChI=1S/C16H25NO4S/c1-12-6-8-14(9-7-12)22(19,20)21-11-13-10-15(2,3)17(18)16(13,4)5/h6-9,13,18H,10-11H2,1-5H3 |
| InChIKey | FUXJJPHHUNUWGY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|