C12H25N2O2+ — CID 142022752
[2,2,6,6-tetramethyl-4-(propanoylamino)piperidin-1-yl]oxidanium (PubChem CID 142022752) has the molecular formula C12H25N2O2+ and a molecular weight of 229.34 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-4-(propanoylamino)piperidin-1-yl]oxidanium.
| Compound Name | [2,2,6,6-tetramethyl-4-(propanoylamino)piperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 142022752 |
| Molecular Formula | C12H25N2O2+ |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | [2,2,6,6-tetramethyl-4-(propanoylamino)piperidin-1-yl]oxidanium |
| SMILES | CCC(=O)NC1CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-6-10(15)13-9-7-11(2,3)14(16)12(4,5)8-9/h9,16H,6-8H2,1-5H3,(H,13,15)/p+1 |
| InChIKey | VULMOPWNFFBLSB-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|