C10H21N3O2 — CID 4120164
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 4120164) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 4120164 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(N)=O)CC(C)(C)N1O |
| InChI | InChI=1S/C10H21N3O2/c1-9(2)5-7(12-8(11)14)6-10(3,4)13(9)15/h7,15H,5-6H2,1-4H3,(H3,11,12,14) |
| InChIKey | WZYCXRQTSWOSNZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |