C15H30N2O — CID 113359655
5-amino-N-(3,3,5,5-tetramethylcyclohexyl)pentanamide (PubChem CID 113359655) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 5-amino-N-(3,3,5,5-tetramethylcyclohexyl)pentanamide.
| Compound Name | 5-amino-N-(3,3,5,5-tetramethylcyclohexyl)pentanamide |
|---|---|
| PubChem CID | 113359655 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 5-amino-N-(3,3,5,5-tetramethylcyclohexyl)pentanamide |
| SMILES | CC1(C)CC(NC(=O)CCCCN)CC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O/c1-14(2)9-12(10-15(3,4)11-14)17-13(18)7-5-6-8-16/h12H,5-11,16H2,1-4H3,(H,17,18) |
| InChIKey | GMVWMICQSBSVSY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|