C11H22N2O2 — CID 114629795
5-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)pentanamide (PubChem CID 114629795) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)pentanamide.
| Compound Name | 5-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)pentanamide |
|---|---|
| PubChem CID | 114629795 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 5-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)pentanamide |
| SMILES | CC1(C)C(O)CC1NC(=O)CCCCN |
| InChI | InChI=1S/C11H22N2O2/c1-11(2)8(7-9(11)14)13-10(15)5-3-4-6-12/h8-9,14H,3-7,12H2,1-2H3,(H,13,15) |
| InChIKey | MTTACDKLMCZJCC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|