C10H20N2O2 — CID 104940471
(2R)-2-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)butanamide (PubChem CID 104940471) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2R)-2-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)butanamide.
| Compound Name | (2R)-2-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)butanamide |
|---|---|
| PubChem CID | 104940471 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (2R)-2-amino-N-(3-hydroxy-2,2-dimethylcyclobutyl)butanamide |
| SMILES | CC[C@@H](N)C(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-4-6(11)9(14)12-7-5-8(13)10(7,2)3/h6-8,13H,4-5,11H2,1-3H3,(H,12,14)/t6-,7?,8?/m1/s1 |
| InChIKey | PEUMQJZBUGIWFM-JECWYVHBSA-N |
| XLogP | -0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |