C12H24N2O2 — CID 104878201
(2R)-2-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)butanamide (PubChem CID 104878201) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2R)-2-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)butanamide.
| Compound Name | (2R)-2-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)butanamide |
|---|---|
| PubChem CID | 104878201 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (2R)-2-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)butanamide |
| SMILES | CCOC1CC(NC(=O)[C@H](N)CC)C1(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-5-8(13)11(15)14-9-7-10(16-6-2)12(9,3)4/h8-10H,5-7,13H2,1-4H3,(H,14,15)/t8-,9?,10?/m1/s1 |
| InChIKey | GJIZGCKKBXQBDM-XNWIYYODSA-N |
| XLogP | 1.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |