C16H32N2O2 — CID 119819267
(2S)-2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3,3-dimethylbutanamide (PubChem CID 119819267) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119819267 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | (2S)-2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3,3-dimethylbutanamide |
| SMILES | CCCCOC1CC(NC(=O)[C@@H](N)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-7-8-9-20-12-10-11(16(12,5)6)18-14(19)13(17)15(2,3)4/h11-13H,7-10,17H2,1-6H3,(H,18,19)/t11?,12?,13-/m1/s1 |
| InChIKey | UBEFYMAKCJPZOZ-WXRRBKDZSA-N |
| XLogP | 2.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|