C15H30N2O2 — CID 120563993
4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)pentanamide (PubChem CID 120563993) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)pentanamide.
| Compound Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)pentanamide |
|---|---|
| PubChem CID | 120563993 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)pentanamide |
| SMILES | CCCCOC1CC(NC(=O)CCC(C)N)C1(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-5-6-9-19-13-10-12(15(13,3)4)17-14(18)8-7-11(2)16/h11-13H,5-10,16H2,1-4H3,(H,17,18) |
| InChIKey | MEMRYTNRRJZTNC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|