C13H27NO2 — CID 103922183
(2R)-1-[(3-butoxy-2,2-dimethylcyclobutyl)amino]propan-2-ol (PubChem CID 103922183) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is (2R)-1-[(3-butoxy-2,2-dimethylcyclobutyl)amino]propan-2-ol.
| Compound Name | (2R)-1-[(3-butoxy-2,2-dimethylcyclobutyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103922183 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (2R)-1-[(3-butoxy-2,2-dimethylcyclobutyl)amino]propan-2-ol |
| SMILES | CCCCOC1CC(NC[C@@H](C)O)C1(C)C |
| InChI | InChI=1S/C13H27NO2/c1-5-6-7-16-12-8-11(13(12,3)4)14-9-10(2)15/h10-12,14-15H,5-9H2,1-4H3/t10-,11?,12?/m1/s1 |
| InChIKey | OFZVIMQBNWTIRC-VOMCLLRMSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|