C15H31ClN2O3 — CID 120594260
4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3-methoxybutanamide;hydrochloride (PubChem CID 120594260) has the molecular formula C15H31ClN2O3 and a molecular weight of 322.88 g/mol. Its IUPAC name is 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120594260 |
| Molecular Formula | C15H31ClN2O3 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-3-methoxybutanamide;hydrochloride |
| SMILES | CCCCOC1CC(NC(=O)CC(CN)OC)C1(C)C.Cl |
| InChI | InChI=1S/C15H30N2O3.ClH/c1-5-6-7-20-13-9-12(15(13,2)3)17-14(18)8-11(10-16)19-4;/h11-13H,5-10,16H2,1-4H3,(H,17,18);1H |
| InChIKey | COWPGFONRKBRHW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|