C16H33ClN2O2 — CID 119819292
2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-2-methylpentanamide;hydrochloride (PubChem CID 119819292) has the molecular formula C16H33ClN2O2 and a molecular weight of 320.91 g/mol. Its IUPAC name is 2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119819292 |
| Molecular Formula | C16H33ClN2O2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-2-methylpentanamide;hydrochloride |
| SMILES | CCCCOC1CC(NC(=O)C(C)(N)CCC)C1(C)C.Cl |
| InChI | InChI=1S/C16H32N2O2.ClH/c1-6-8-10-20-13-11-12(15(13,3)4)18-14(19)16(5,17)9-7-2;/h12-13H,6-11,17H2,1-5H3,(H,18,19);1H |
| InChIKey | MLDZNNBONWIOMF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|