C11H21NO2 — CID 114631068
N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbutanamide (PubChem CID 114631068) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbutanamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 114631068 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C11H21NO2/c1-7(2)5-10(14)12-8-6-9(13)11(8,3)4/h7-9,13H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | FKCMHZFMWPHWGJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |