C19H36N2O3 — CID 11638683
10-oxo-10-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]decanoic acid (PubChem CID 11638683) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is 10-oxo-10-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]decanoic acid.
| Compound Name | 10-oxo-10-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]decanoic acid |
|---|---|
| PubChem CID | 11638683 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | 10-oxo-10-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]decanoic acid |
| SMILES | CC1(C)CC(NC(=O)CCCCCCCCC(=O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C19H36N2O3/c1-18(2)13-15(14-19(3,4)21-18)20-16(22)11-9-7-5-6-8-10-12-17(23)24/h15,21H,5-14H2,1-4H3,(H,20,22)(H,23,24) |
| InChIKey | YGRYRORZEHPSBX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|