C28H58N4O4 — CID 118368680
azane;2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid (PubChem CID 118368680) has the molecular formula C28H58N4O4 and a molecular weight of 514.80 g/mol. Its IUPAC name is azane;2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid.
| Compound Name | azane;2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 118368680 |
| Molecular Formula | C28H58N4O4 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.45 |
| IUPAC Name | azane;2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
| SMILES | CC1(C)CC(C(CCCCCCCC(=O)O)(C(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.N.N |
| InChI | InChI=1S/C28H52N2O4.2H3N/c1-24(2)16-20(17-25(3,4)29-24)28(23(33)34,15-13-11-9-10-12-14-22(31)32)21-18-26(5,6)30-27(7,8)19-21;;/h20-21,29-30H,9-19H2,1-8H3,(H,31,32)(H,33,34);2*1H3 |
| InChIKey | NEZXZXHOJXJILL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|