C28H50I2N2O4 — CID 70156589
2,2-bis(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)decanedioic acid diiodide (PubChem CID 70156589) has the molecular formula C28H50I2N2O4 and a molecular weight of 732.53 g/mol. Its IUPAC name is 2,2-bis(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)decanedioic acid diiodide.
| Compound Name | 2,2-bis(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)decanedioic acid diiodide |
|---|---|
| PubChem CID | 70156589 |
| Molecular Formula | C28H50I2N2O4 |
| Molecular Weight | 732.53 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | 2,2-bis(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)decanedioic acid diiodide |
| SMILES | C[N+]1(C)C2CCC1CC(C(CCCCCCCC(=O)O)(C(=O)O)C1CC3CCC(C1)[N+]3(C)C)C2.[I-].[I-] |
| InChI | InChI=1S/C28H48N2O4.2HI/c1-29(2)22-11-12-23(29)17-20(16-22)28(27(33)34,15-9-7-5-6-8-10-26(31)32)21-18-24-13-14-25(19-21)30(24,3)4;;/h20-25H,5-19H2,1-4H3;2*1H |
| InChIKey | FPLBMQSHVMWZTO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.53 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|