C26H44N2O4 — CID 22615856
2,2-bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)decanedioic acid (PubChem CID 22615856) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is 2,2-bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)decanedioic acid.
| Compound Name | 2,2-bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)decanedioic acid |
|---|---|
| PubChem CID | 22615856 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 2,2-bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)decanedioic acid |
| SMILES | CN1C2CCC1CC(C(CCCCCCCC(=O)O)(C(=O)O)C1CC3CCC(C1)N3C)C2 |
| InChI | InChI=1S/C26H44N2O4/c1-27-20-9-10-21(27)15-18(14-20)26(25(31)32,13-7-5-3-4-6-8-24(29)30)19-16-22-11-12-23(17-19)28(22)2/h18-23H,3-17H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | AXTVRVYSOYAJFD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|