About bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate
bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate (PubChem CID 22615900) has the molecular formula C26H44N2O4
and a molecular weight of 448.65 g/mol. Its IUPAC name is bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate.
Molecular Properties
| Compound Name | bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate |
| PubChem CID | 22615900 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate |
| SMILES | CN1C2CCC1CC(OC(=O)CCCCCCCCC(=O)OC1CC3CCC(C1)N3C)C2 |
| InChI | InChI=1S/C26H44N2O4/c1-27-19-11-12-20(27)16-23(15-19)31-25(29)9-7-5-3-4-6-8-10-26(30)32-24-17-21-13-14-22(18-24)28(21)2/h19-24H,3-18H2,1-2H3 |
| InChIKey | SVAISAJCOWSBLM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate?
The IUPAC name of bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate (CID 22615900) is bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate.
What is the SMILES notation for bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate?
The canonical SMILES for bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate is CN1C2CCC1CC(OC(=O)CCCCCCCCC(=O)OC1CC3CCC(C1)N3C)C2.
What is the InChIKey of bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate?
The InChIKey is SVAISAJCOWSBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44N2O4/c1-27-19-11-12-20(27)16-23(15-19)31-25(29)9-7-5-3-4-6-8-10-26(30)32-24-17-21-13-14-22(18-24)28(21)2/h19-24H,3-18H2,1-2H3.
What are the key properties of bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate?
bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate has a molecular weight of 448.65 g/mol, XLogP of 4.44, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) decanedioate is sourced from PubChem (CID 22615900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).