About bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide
bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide (PubChem CID 70248010) has the molecular formula C26H46I2N2O4
and a molecular weight of 704.47 g/mol. Its IUPAC name is bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide.
Molecular Properties
| Compound Name | bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide |
| PubChem CID | 70248010 |
| Molecular Formula | C26H46I2N2O4 |
| Molecular Weight | 704.47 g/mol |
| Exact Mass | 704.15 |
| IUPAC Name | bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide |
| SMILES | CC[N+]1(C)C2CCC1CC(OC(=O)CCCCC(=O)OC1CC3CCC(C1)[N+]3(C)CC)C2.[I-].[I-] |
| InChI | InChI=1S/C26H46N2O4.2HI/c1-5-27(3)19-11-12-20(27)16-23(15-19)31-25(29)9-7-8-10-26(30)32-24-17-21-13-14-22(18-24)28(21,4)6-2;;/h19-24H,5-18H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | WGTGPQYXPCPVNR-UHFFFAOYSA-L |
| XLogP | -2.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 704.47 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide?
The IUPAC name of bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide (CID 70248010) is bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide.
What is the SMILES notation for bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide?
The canonical SMILES for bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide is CC[N+]1(C)C2CCC1CC(OC(=O)CCCCC(=O)OC1CC3CCC(C1)[N+]3(C)CC)C2.[I-].[I-].
What is the InChIKey of bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide?
The InChIKey is WGTGPQYXPCPVNR-UHFFFAOYSA-L. The full InChI is InChI=1S/C26H46N2O4.2HI/c1-5-27(3)19-11-12-20(27)16-23(15-19)31-25(29)9-7-8-10-26(30)32-24-17-21-13-14-22(18-24)28(21,4)6-2;;/h19-24H,5-18H2,1-4H3;2*1H/q+2;;/p-2.
What are the key properties of bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide?
bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide has a molecular weight of 704.47 g/mol, XLogP of -2.04, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) hexanedioate diiodide is sourced from PubChem (CID 70248010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).