C21H34O5 — CID 170274436
1-O-[(1R,3R,4S)-3,4-dimethylcyclohexyl] 7-O-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl] heptanedioate (PubChem CID 170274436) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-O-[(1R,3R,4S)-3,4-dimethylcyclohexyl] 7-O-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl] heptanedioate.
| Compound Name | 1-O-[(1R,3R,4S)-3,4-dimethylcyclohexyl] 7-O-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl] heptanedioate |
|---|---|
| PubChem CID | 170274436 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-O-[(1R,3R,4S)-3,4-dimethylcyclohexyl] 7-O-[(1R,3R,6S)-7-oxabicyclo[4.1.0]heptan-3-yl] heptanedioate |
| SMILES | C[C@@H]1C[C@H](OC(=O)CCCCCC(=O)O[C@@H]2CC[C@@H]3O[C@@H]3C2)CC[C@@H]1C |
| InChI | InChI=1S/C21H34O5/c1-14-8-9-16(12-15(14)2)24-20(22)6-4-3-5-7-21(23)25-17-10-11-18-19(13-17)26-18/h14-19H,3-13H2,1-2H3/t14-,15+,16+,17+,18-,19+/m0/s1 |
| InChIKey | UGDOPJLHNDZACD-QZIZDEJHSA-N |
| XLogP | 4.17 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|