C22H34O6 — CID 142748785
bis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl] hexanedioate (PubChem CID 142748785) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is bis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl] hexanedioate.
| Compound Name | bis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl] hexanedioate |
|---|---|
| PubChem CID | 142748785 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | bis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl] hexanedioate |
| SMILES | O=C(CCCCC(=O)OCCC1CCC2OC2C1)OCCC1CCC2OC2C1 |
| InChI | InChI=1S/C22H34O6/c23-21(25-11-9-15-5-7-17-19(13-15)27-17)3-1-2-4-22(24)26-12-10-16-6-8-18-20(14-16)28-18/h15-20H,1-14H2 |
| InChIKey | BHTZIIGJSRQGAS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|