C20H28O6 — CID 147523132
1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 6-O-(7-oxabicyclo[4.1.0]hept-1-en-3-ylmethyl) hexanedioate (PubChem CID 147523132) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 6-O-(7-oxabicyclo[4.1.0]hept-1-en-3-ylmethyl) hexanedioate.
| Compound Name | 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 6-O-(7-oxabicyclo[4.1.0]hept-1-en-3-ylmethyl) hexanedioate |
|---|---|
| PubChem CID | 147523132 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 6-O-(7-oxabicyclo[4.1.0]hept-1-en-3-ylmethyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCC1CCC2OC2C1)OCC1C=C2OC2CC1 |
| InChI | InChI=1S/C20H28O6/c21-19(23-11-13-5-7-15-17(9-13)25-15)3-1-2-4-20(22)24-12-14-6-8-16-18(10-14)26-16/h9,13-16,18H,1-8,10-12H2 |
| InChIKey | FLOCIGDUESEUOK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|