C16H24O4 — CID 59936733
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propanoate (PubChem CID 59936733) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propanoate |
|---|---|
| PubChem CID | 59936733 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 3-(7-oxabicyclo[4.1.0]heptan-3-yl)propanoate |
| SMILES | O=C(CCC1CCC2OC2C1)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C16H24O4/c17-16(6-3-10-1-4-12-14(7-10)19-12)18-9-11-2-5-13-15(8-11)20-13/h10-15H,1-9H2 |
| InChIKey | TYDUQAUSJKTYJU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|