C9H14O4 — CID 59330504
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2-hydroxyacetate (PubChem CID 59330504) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2-hydroxyacetate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 59330504 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2-hydroxyacetate |
| SMILES | O=C(CO)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C9H14O4/c10-4-9(11)12-5-6-1-2-7-8(3-6)13-7/h6-8,10H,1-5H2 |
| InChIKey | NFBLCBMJPXOGTD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|