C28H41N3O11 — CID 167130763
3-[2-hydroxy-3,5-bis[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-4-oxobutyl]-4,6-dioxo-1,3,5-triazinan-1-yl]propanoic acid (PubChem CID 167130763) has the molecular formula C28H41N3O11 and a molecular weight of 595.65 g/mol. Its IUPAC name is 3-[2-hydroxy-3,5-bis[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-4-oxobutyl]-4,6-dioxo-1,3,5-triazinan-1-yl]propanoic acid.
| Compound Name | 3-[2-hydroxy-3,5-bis[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-4-oxobutyl]-4,6-dioxo-1,3,5-triazinan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 167130763 |
| Molecular Formula | C28H41N3O11 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 3-[2-hydroxy-3,5-bis[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-4-oxobutyl]-4,6-dioxo-1,3,5-triazinan-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)N(CCCC(=O)OCC2CCC3OC3C2)C(=O)N(CCCC(=O)OCC2CCC3OC3C2)C1O |
| InChI | InChI=1S/C28H41N3O11/c32-23(33)9-12-31-27(37)29(10-1-3-24(34)39-15-17-5-7-19-21(13-17)41-19)26(36)30(28(31)38)11-2-4-25(35)40-16-18-6-8-20-22(14-18)42-20/h17-22,27,37H,1-16H2,(H,32,33) |
| InChIKey | PKGWJDRRFLDFCA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|