About [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate
[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate (PubChem CID 98116142) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate.
Molecular Properties
| Compound Name | [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate |
| PubChem CID | 98116142 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate |
| SMILES | CCN(CC)CCC(=O)OC1C[C@H]2CC[C@H](C1)N2C |
| InChI | InChI=1S/C15H28N2O2/c1-4-17(5-2)9-8-15(18)19-14-10-12-6-7-13(11-14)16(12)3/h12-14H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | VFRSYAZEERKDHH-CHWSQXEVSA-N |
| XLogP | 1.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate?
The IUPAC name of [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate (CID 98116142) is [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate.
What is the SMILES notation for [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate?
The canonical SMILES for [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate is CCN(CC)CCC(=O)OC1C[C@H]2CC[C@H](C1)N2C.
What is the InChIKey of [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate?
The InChIKey is VFRSYAZEERKDHH-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-4-17(5-2)9-8-15(18)19-14-10-12-6-7-13(11-14)16(12)3/h12-14H,4-11H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate?
[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate has a molecular weight of 268.40 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(diethylamino)propanoate is sourced from PubChem (CID 98116142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).