C18H31NO4 — CID 141021140
[(1S,3S,5R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] octanoate (PubChem CID 141021140) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is [(1S,3S,5R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] octanoate.
| Compound Name | [(1S,3S,5R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] octanoate |
|---|---|
| PubChem CID | 141021140 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | [(1S,3S,5R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1C[C@H]2C[C@H](OC(C)=O)[C@@H](C1)N2C |
| InChI | InChI=1S/C18H31NO4/c1-4-5-6-7-8-9-18(21)23-15-10-14-11-17(22-13(2)20)16(12-15)19(14)3/h14-17H,4-12H2,1-3H3/t14-,15-,16+,17-/m0/s1 |
| InChIKey | GEBXVKMFYZIRIJ-NXOAAHMSSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|