C20H36N2O6 — CID 19780675
2,2-bis(1-hydroxypiperidin-4-yl)decanedioic acid (PubChem CID 19780675) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2,2-bis(1-hydroxypiperidin-4-yl)decanedioic acid.
| Compound Name | 2,2-bis(1-hydroxypiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 19780675 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2,2-bis(1-hydroxypiperidin-4-yl)decanedioic acid |
| SMILES | O=C(O)CCCCCCCC(C(=O)O)(C1CCN(O)CC1)C1CCN(O)CC1 |
| InChI | InChI=1S/C20H36N2O6/c23-18(24)6-4-2-1-3-5-11-20(19(25)26,16-7-12-21(27)13-8-16)17-9-14-22(28)15-10-17/h16-17,27-28H,1-15H2,(H,23,24)(H,25,26) |
| InChIKey | CAVZHVZDGIPFEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|