C27H50N2O4 — CID 21293228
2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)nonanedioic acid (PubChem CID 21293228) has the molecular formula C27H50N2O4 and a molecular weight of 466.71 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)nonanedioic acid.
| Compound Name | 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)nonanedioic acid |
|---|---|
| PubChem CID | 21293228 |
| Molecular Formula | C27H50N2O4 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)nonanedioic acid |
| SMILES | CC1(C)CC(C(CCCCCCC(=O)O)(C(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C27H50N2O4/c1-23(2)15-19(16-24(3,4)28-23)27(22(32)33,14-12-10-9-11-13-21(30)31)20-17-25(5,6)29-26(7,8)18-20/h19-20,28-29H,9-18H2,1-8H3,(H,30,31)(H,32,33) |
| InChIKey | FIZYYMYJTTZJIO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|