C25H46N2O4 — CID 21293230
2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)heptanedioic acid (PubChem CID 21293230) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)heptanedioic acid.
| Compound Name | 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)heptanedioic acid |
|---|---|
| PubChem CID | 21293230 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)heptanedioic acid |
| SMILES | CC1(C)CC(C(CCCCC(=O)O)(C(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C25H46N2O4/c1-21(2)13-17(14-22(3,4)26-21)25(20(30)31,12-10-9-11-19(28)29)18-15-23(5,6)27-24(7,8)16-18/h17-18,26-27H,9-16H2,1-8H3,(H,28,29)(H,30,31) |
| InChIKey | DKSTYMRZGRCIEY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|