C17H33NO2 — CID 68877413
2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hexanoic acid (PubChem CID 68877413) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hexanoic acid.
| Compound Name | 2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 68877413 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hexanoic acid |
| SMILES | CCCCC(CC)(C(=O)O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H33NO2/c1-7-9-10-17(8-2,14(19)20)13-11-15(3,4)18-16(5,6)12-13/h13,18H,7-12H2,1-6H3,(H,19,20) |
| InChIKey | NMQNAFORSYRKPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |