C17H35NO2 — CID 139492039
2,2-dimethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexan-1-ol (PubChem CID 139492039) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexan-1-ol.
| Compound Name | 2,2-dimethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexan-1-ol |
|---|---|
| PubChem CID | 139492039 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 2,2-dimethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexan-1-ol |
| SMILES | CCCCC(C)(C)C(O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H35NO2/c1-8-9-10-15(2,3)14(19)20-13-11-16(4,5)18-17(6,7)12-13/h13-14,18-19H,8-12H2,1-7H3 |
| InChIKey | FUCRPBDLTXUTDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|