C28H56N2O2 — CID 167575636
1,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,1-diol (PubChem CID 167575636) has the molecular formula C28H56N2O2 and a molecular weight of 452.77 g/mol. Its IUPAC name is 1,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,1-diol.
| Compound Name | 1,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,1-diol |
|---|---|
| PubChem CID | 167575636 |
| Molecular Formula | C28H56N2O2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.43 |
| IUPAC Name | 1,2-bis(2,2,6,6-tetramethylpiperidin-4-yl)decane-1,1-diol |
| SMILES | CCCCCCCCC(C1CC(C)(C)NC(C)(C)C1)C(O)(O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C28H56N2O2/c1-10-11-12-13-14-15-16-23(21-17-24(2,3)29-25(4,5)18-21)28(31,32)22-19-26(6,7)30-27(8,9)20-22/h21-23,29-32H,10-20H2,1-9H3 |
| InChIKey | GMLHZLHVWMVXIE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|