C27H51NO2 — CID 71130144
(2,2,6,6-tetramethylpiperidin-4-yl) 2-hexyl-5-methylundec-3-enoate (PubChem CID 71130144) has the molecular formula C27H51NO2 and a molecular weight of 421.71 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 2-hexyl-5-methylundec-3-enoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 2-hexyl-5-methylundec-3-enoate |
|---|---|
| PubChem CID | 71130144 |
| Molecular Formula | C27H51NO2 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 421.39 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 2-hexyl-5-methylundec-3-enoate |
| SMILES | CCCCCCC(C)C=CC(CCCCCC)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H51NO2/c1-8-10-12-14-16-22(3)18-19-23(17-15-13-11-9-2)25(29)30-24-20-26(4,5)28-27(6,7)21-24/h18-19,22-24,28H,8-17,20-21H2,1-7H3 |
| InChIKey | FGNBMYHVFFKXSD-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|