C44H78N4O8 — CID 54136975
tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,1,2-tetracarboxylate (PubChem CID 54136975) has the molecular formula C44H78N4O8 and a molecular weight of 791.13 g/mol. Its IUPAC name is tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,1,2-tetracarboxylate.
| Compound Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,1,2-tetracarboxylate |
|---|---|
| PubChem CID | 54136975 |
| Molecular Formula | C44H78N4O8 |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 790.58 |
| IUPAC Name | tetrakis(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,1,1,2-tetracarboxylate |
| SMILES | CCC(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(C(=O)OC1CC(C)(C)NC(C)(C)C1)(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C44H78N4O8/c1-18-31(32(49)53-27-19-36(2,3)45-37(4,5)20-27)44(33(50)54-28-21-38(6,7)46-39(8,9)22-28,34(51)55-29-23-40(10,11)47-41(12,13)24-29)35(52)56-30-25-42(14,15)48-43(16,17)26-30/h27-31,45-48H,18-26H2,1-17H3 |
| InChIKey | NYKHQQHUHLNYLW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|