C21H40N2O4 — CID 90832093
6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]undecanoic acid (PubChem CID 90832093) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is 6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]undecanoic acid.
| Compound Name | 6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]undecanoic acid |
|---|---|
| PubChem CID | 90832093 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]undecanoic acid |
| SMILES | CCCCCC(CCCCC(=O)O)NC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H40N2O4/c1-6-7-8-11-16(12-9-10-13-18(24)25)22-19(26)27-17-14-20(2,3)23-21(4,5)15-17/h16-17,23H,6-15H2,1-5H3,(H,22,26)(H,24,25) |
| InChIKey | HZLZLQCSZVKGSU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|