C25H47N3O4 — CID 22725764
2-(2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid (PubChem CID 22725764) has the molecular formula C25H47N3O4 and a molecular weight of 453.67 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 22725764 |
| Molecular Formula | C25H47N3O4 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.36 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC1(C)CC(OC(=O)NCCCCC(C(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C25H47N3O4/c1-22(2)13-17(14-23(3,4)27-22)19(20(29)30)11-9-10-12-26-21(31)32-18-15-24(5,6)28-25(7,8)16-18/h17-19,27-28H,9-16H2,1-8H3,(H,26,31)(H,29,30) |
| InChIKey | ITDVLPIZPBYSAI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|