C20H36N2O4 — CID 67207902
2,2-di(piperidin-1-yl)decanedioic acid (PubChem CID 67207902) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2,2-di(piperidin-1-yl)decanedioic acid.
| Compound Name | 2,2-di(piperidin-1-yl)decanedioic acid |
|---|---|
| PubChem CID | 67207902 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2,2-di(piperidin-1-yl)decanedioic acid |
| SMILES | O=C(O)CCCCCCCC(C(=O)O)(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C20H36N2O4/c23-18(24)12-6-2-1-3-7-13-20(19(25)26,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h1-17H2,(H,23,24)(H,25,26) |
| InChIKey | VQKPVANFSQWOTC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|