C15H28N2O2 — CID 123799217
3-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide (PubChem CID 123799217) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide.
| Compound Name | 3-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 123799217 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3-methyl-4-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
| SMILES | CC(=O)C(C)CC(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-10(11(2)18)7-13(19)16-12-8-14(3,4)17-15(5,6)9-12/h10,12,17H,7-9H2,1-6H3,(H,16,19) |
| InChIKey | YXJSDRNMPTVSPG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |