C22H32N3O2 — CID 101467354
CID 101467354 (PubChem CID 101467354) has the molecular formula C22H32N3O2 and a molecular weight of 370.52 g/mol.
| Compound Name | CID 101467354 |
|---|---|
| PubChem CID | 101467354 |
| Molecular Formula | C22H32N3O2 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | — |
| SMILES | C#CCN(C)Cc1ccc(CC(=O)NC2CC(C)(C)N([O])C(C)(C)C2)cc1 |
| InChI | InChI=1S/C22H32N3O2/c1-7-12-24(6)16-18-10-8-17(9-11-18)13-20(26)23-19-14-21(2,3)25(27)22(4,5)15-19/h1,8-11,19H,12-16H2,2-6H3,(H,23,26) |
| InChIKey | JJIOPOQLLJGARK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|