C22H41FN2O4 — CID 134387390
N-[3-[3-[3-(cyclooctylamino)-3-oxopropoxy]-3-methylbutoxy]-3-methylbutyl]carbamoyl fluoride (PubChem CID 134387390) has the molecular formula C22H41FN2O4 and a molecular weight of 416.58 g/mol. Its IUPAC name is N-[3-[3-[3-(cyclooctylamino)-3-oxopropoxy]-3-methylbutoxy]-3-methylbutyl]carbamoyl fluoride.
| Compound Name | N-[3-[3-[3-(cyclooctylamino)-3-oxopropoxy]-3-methylbutoxy]-3-methylbutyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 134387390 |
| Molecular Formula | C22H41FN2O4 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | N-[3-[3-[3-(cyclooctylamino)-3-oxopropoxy]-3-methylbutoxy]-3-methylbutyl]carbamoyl fluoride |
| SMILES | CC(C)(CCNC(=O)F)OCCC(C)(C)OCCC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H41FN2O4/c1-21(2,13-15-24-20(23)27)29-17-14-22(3,4)28-16-12-19(26)25-18-10-8-6-5-7-9-11-18/h18H,5-17H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | BPMYNKTWBXXROS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|