C26H43NO2 — CID 167068116
N-(2-cycloheptylethyl)-4-methyl-4-(3-methyl-3-phenylbutoxy)pentanamide (PubChem CID 167068116) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is N-(2-cycloheptylethyl)-4-methyl-4-(3-methyl-3-phenylbutoxy)pentanamide.
| Compound Name | N-(2-cycloheptylethyl)-4-methyl-4-(3-methyl-3-phenylbutoxy)pentanamide |
|---|---|
| PubChem CID | 167068116 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | N-(2-cycloheptylethyl)-4-methyl-4-(3-methyl-3-phenylbutoxy)pentanamide |
| SMILES | CC(C)(CCC(=O)NCCC1CCCCCC1)OCCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H43NO2/c1-25(2,23-14-10-7-11-15-23)19-21-29-26(3,4)18-16-24(28)27-20-17-22-12-8-5-6-9-13-22/h7,10-11,14-15,22H,5-6,8-9,12-13,16-21H2,1-4H3,(H,27,28) |
| InChIKey | UKEHMNADWDXHLP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |