C18H35N3O2 — CID 111608920
methyl 6-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]hexanoate (PubChem CID 111608920) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is methyl 6-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]hexanoate.
| Compound Name | methyl 6-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]hexanoate |
|---|---|
| PubChem CID | 111608920 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | methyl 6-[[N-(4-cyclopentylbutyl)-N'-methylcarbamimidoyl]amino]hexanoate |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NCCCCC1CCCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-19-18(20-14-8-3-4-13-17(22)23-2)21-15-9-7-12-16-10-5-6-11-16/h16H,3-15H2,1-2H3,(H2,19,20,21) |
| InChIKey | BZMTVINPEACRAY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|