C13H28N2O2 — CID 174683339
N-butyl-1-hydroperoxy-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 174683339) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-butyl-1-hydroperoxy-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-butyl-1-hydroperoxy-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 174683339 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | N-butyl-1-hydroperoxy-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCNC1CC(C)(C)N(OO)C(C)(C)C1 |
| InChI | InChI=1S/C13H28N2O2/c1-6-7-8-14-11-9-12(2,3)15(17-16)13(4,5)10-11/h11,14,16H,6-10H2,1-5H3 |
| InChIKey | FHXMWZIEIUEOTJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|