About CID 162696886
CID 162696886 (PubChem CID 162696886) has the molecular formula C19H40N2O3Si
and a molecular weight of 372.63 g/mol.
Molecular Properties
| Compound Name | CID 162696886 |
| PubChem CID | 162696886 |
| Molecular Formula | C19H40N2O3Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)[Si]CCCNC1CC(C)(C)N(OCC)C(C)(C)C1 |
| InChI | InChI=1S/C19H40N2O3Si/c1-8-22-17(23-9-2)25-13-11-12-20-16-14-18(4,5)21(24-10-3)19(6,7)15-16/h16-17,20H,8-15H2,1-7H3 |
| InChIKey | JQIVVPJPQLRWMU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 162696886 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162696886?
The IUPAC name of CID 162696886 (CID 162696886) is not available.
What is the SMILES notation for CID 162696886?
The canonical SMILES for CID 162696886 is CCOC(OCC)[Si]CCCNC1CC(C)(C)N(OCC)C(C)(C)C1.
What is the InChIKey of CID 162696886?
The InChIKey is JQIVVPJPQLRWMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N2O3Si/c1-8-22-17(23-9-2)25-13-11-12-20-16-14-18(4,5)21(24-10-3)19(6,7)15-16/h16-17,20H,8-15H2,1-7H3.
What are the key properties of CID 162696886?
CID 162696886 has a molecular weight of 372.63 g/mol, XLogP of 3.42, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162696886 is sourced from PubChem (CID 162696886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).